C5H3F9O — CID 2775038
1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane (PubChem CID 2775038) has the molecular formula C5H3F9O and a molecular weight of 250.06 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane |
|---|---|
| PubChem CID | 2775038 |
| Molecular Formula | C5H3F9O |
| Molecular Weight | 250.06 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane |
| SMILES | FC(C(F)(F)F)C(F)(F)OCC(F)(F)F |
| InChI | InChI=1S/C5H3F9O/c6-2(4(10,11)12)5(13,14)15-1-3(7,8)9/h2H,1H2 |
| InChIKey | LMRGTZDDPWGCGL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.06 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |