C7H5F9O — CID 2775048
2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]oxirane (PubChem CID 2775048) has the molecular formula C7H5F9O and a molecular weight of 276.10 g/mol. Its IUPAC name is 2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]oxirane.
| Compound Name | 2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]oxirane |
|---|---|
| PubChem CID | 2775048 |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]oxirane |
| SMILES | FC(F)(F)C(F)(F)C(F)(CC1CO1)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O/c8-4(6(11,12)13,1-3-2-17-3)5(9,10)7(14,15)16/h3H,1-2H2 |
| InChIKey | SYBLPUZYAVFTTM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|