C7H7F9O — CID 2775052
4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hexan-1-ol (PubChem CID 2775052) has the molecular formula C7H7F9O and a molecular weight of 278.11 g/mol. Its IUPAC name is 4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hexan-1-ol.
| Compound Name | 4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hexan-1-ol |
|---|---|
| PubChem CID | 2775052 |
| Molecular Formula | C7H7F9O |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hexan-1-ol |
| SMILES | OCCCC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F9O/c8-4(2-1-3-17,6(11,12)13)5(9,10)7(14,15)16/h17H,1-3H2 |
| InChIKey | WHNVWOCZLNZDCM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|