C7H6F9I — CID 2775059
1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)hexane (PubChem CID 2775059) has the molecular formula C7H6F9I and a molecular weight of 388.01 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)hexane.
| Compound Name | 1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 2775059 |
| Molecular Formula | C7H6F9I |
| Molecular Weight | 388.01 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | 1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)hexane |
| SMILES | CC(I)CC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F9I/c1-3(17)2-4(8,6(11,12)13)5(9,10)7(14,15)16/h3H,2H2,1H3 |
| InChIKey | WLYIWDUYKMKZDR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.01 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|