C13H14ClNO5 — CID 2775071
(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl) 3-chloro-2,2-dimethylpropanoate (PubChem CID 2775071) has the molecular formula C13H14ClNO5 and a molecular weight of 299.71 g/mol. Its IUPAC name is (1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl) 3-chloro-2,2-dimethylpropanoate.
| Compound Name | (1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl) 3-chloro-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 2775071 |
| Molecular Formula | C13H14ClNO5 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl) 3-chloro-2,2-dimethylpropanoate |
| SMILES | CC(C)(CCl)C(=O)ON1C(=O)C2C3C=CC(O3)C2C1=O |
| InChI | InChI=1S/C13H14ClNO5/c1-13(2,5-14)12(18)20-15-10(16)8-6-3-4-7(19-6)9(8)11(15)17/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | RLUGIZGNCMVOBE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|