About (2-chloro-3,4-dimethoxyphenyl)methanol
(2-chloro-3,4-dimethoxyphenyl)methanol (PubChem CID 2775134) has the molecular formula C9H11ClO3
and a molecular weight of 202.64 g/mol. Its IUPAC name is (2-chloro-3,4-dimethoxyphenyl)methanol.
Molecular Properties
| Compound Name | (2-chloro-3,4-dimethoxyphenyl)methanol |
| PubChem CID | 2775134 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (2-chloro-3,4-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(CO)c(Cl)c1OC |
| InChI | InChI=1S/C9H11ClO3/c1-12-7-4-3-6(5-11)8(10)9(7)13-2/h3-4,11H,5H2,1-2H3 |
| InChIKey | ZXYBQLFOEYWYBM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chloro-3,4-dimethoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3,4-dimethoxyphenyl)methanol?
The IUPAC name of (2-chloro-3,4-dimethoxyphenyl)methanol (CID 2775134) is (2-chloro-3,4-dimethoxyphenyl)methanol.
What is the SMILES notation for (2-chloro-3,4-dimethoxyphenyl)methanol?
The canonical SMILES for (2-chloro-3,4-dimethoxyphenyl)methanol is COc1ccc(CO)c(Cl)c1OC.
What is the InChIKey of (2-chloro-3,4-dimethoxyphenyl)methanol?
The InChIKey is ZXYBQLFOEYWYBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO3/c1-12-7-4-3-6(5-11)8(10)9(7)13-2/h3-4,11H,5H2,1-2H3.
What are the key properties of (2-chloro-3,4-dimethoxyphenyl)methanol?
(2-chloro-3,4-dimethoxyphenyl)methanol has a molecular weight of 202.64 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3,4-dimethoxyphenyl)methanol is sourced from PubChem (CID 2775134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).