C4F9I — CID 2775165
1,1,1,2,2,3,4,4,4-nonafluoro-3-iodobutane (PubChem CID 2775165) has the molecular formula C4F9I and a molecular weight of 345.93 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,4,4-nonafluoro-3-iodobutane.
| Compound Name | 1,1,1,2,2,3,4,4,4-nonafluoro-3-iodobutane |
|---|---|
| PubChem CID | 2775165 |
| Molecular Formula | C4F9I |
| Molecular Weight | 345.93 g/mol |
| Exact Mass | 345.89 |
| IUPAC Name | 1,1,1,2,2,3,4,4,4-nonafluoro-3-iodobutane |
| SMILES | FC(F)(F)C(F)(F)C(F)(I)C(F)(F)F |
| InChI | InChI=1S/C4F9I/c5-1(6,3(8,9)10)2(7,14)4(11,12)13 |
| InChIKey | FBJVLVWUMYWJMY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.93 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|