About 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene
8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene (PubChem CID 2775484) has the molecular formula C38H33NO3P2
and a molecular weight of 613.63 g/mol. Its IUPAC name is 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene.
Molecular Properties
| Compound Name | 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
| PubChem CID | 2775484 |
| Molecular Formula | C38H33NO3P2 |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)C1C2CC(C3C(c4ccccc4)=NOC23)C1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H33NO3P2/c40-43(28-18-8-2-9-19-28,29-20-10-3-11-21-29)37-32-26-33(36-34(32)35(39-42-36)27-16-6-1-7-17-27)38(37)44(41,30-22-12-4-13-23-30)31-24-14-5-15-25-31/h1-25,32-34,36-38H,26H2 |
| InChIKey | PCPWWUPRFBJKIV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene?
The IUPAC name of 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene (CID 2775484) is 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene.
What is the SMILES notation for 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene?
The canonical SMILES for 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene is O=P(c1ccccc1)(c1ccccc1)C1C2CC(C3C(c4ccccc4)=NOC23)C1P(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene?
The InChIKey is PCPWWUPRFBJKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H33NO3P2/c40-43(28-18-8-2-9-19-28,29-20-10-3-11-21-29)37-32-26-33(36-34(32)35(39-42-36)27-16-6-1-7-17-27)38(37)44(41,30-22-12-4-13-23-30)31-24-14-5-15-25-31/h1-25,32-34,36-38H,26H2.
What are the key properties of 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene?
8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene has a molecular weight of 613.63 g/mol, XLogP of 6.82, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-bis(diphenylphosphoryl)-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene is sourced from PubChem (CID 2775484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).