About 3,4-dihydro-2H-1,5-benzodioxepin-7-amine
3,4-dihydro-2H-1,5-benzodioxepin-7-amine (PubChem CID 2775654) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,5-benzodioxepin-7-amine.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
| PubChem CID | 2775654 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
| SMILES | Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C9H11NO2/c10-7-2-3-8-9(6-7)12-5-1-4-11-8/h2-3,6H,1,4-5,10H2 |
| InChIKey | FVLCICVRAPEYNX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-2H-1,5-benzodioxepin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,5-benzodioxepin-7-amine?
The IUPAC name of 3,4-dihydro-2H-1,5-benzodioxepin-7-amine (CID 2775654) is 3,4-dihydro-2H-1,5-benzodioxepin-7-amine.
What is the SMILES notation for 3,4-dihydro-2H-1,5-benzodioxepin-7-amine?
The canonical SMILES for 3,4-dihydro-2H-1,5-benzodioxepin-7-amine is Nc1ccc2c(c1)OCCCO2.
What is the InChIKey of 3,4-dihydro-2H-1,5-benzodioxepin-7-amine?
The InChIKey is FVLCICVRAPEYNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c10-7-2-3-8-9(6-7)12-5-1-4-11-8/h2-3,6H,1,4-5,10H2.
What are the key properties of 3,4-dihydro-2H-1,5-benzodioxepin-7-amine?
3,4-dihydro-2H-1,5-benzodioxepin-7-amine has a molecular weight of 165.19 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,5-benzodioxepin-7-amine is sourced from PubChem (CID 2775654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).