About N-(3-chlorophenyl)-2,4-dinitroaniline
N-(3-chlorophenyl)-2,4-dinitroaniline (PubChem CID 27757) has the molecular formula C12H8ClN3O4
and a molecular weight of 293.67 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,4-dinitroaniline.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-2,4-dinitroaniline |
| PubChem CID | 27757 |
| Molecular Formula | C12H8ClN3O4 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | N-(3-chlorophenyl)-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(Nc2cccc(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H8ClN3O4/c13-8-2-1-3-9(6-8)14-11-5-4-10(15(17)18)7-12(11)16(19)20/h1-7,14H |
| InChIKey | YLMKHXBXDKWQSO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chlorophenyl)-2,4-dinitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-2,4-dinitroaniline?
The IUPAC name of N-(3-chlorophenyl)-2,4-dinitroaniline (CID 27757) is N-(3-chlorophenyl)-2,4-dinitroaniline.
What is the SMILES notation for N-(3-chlorophenyl)-2,4-dinitroaniline?
The canonical SMILES for N-(3-chlorophenyl)-2,4-dinitroaniline is O=[N+]([O-])c1ccc(Nc2cccc(Cl)c2)c([N+](=O)[O-])c1.
What is the InChIKey of N-(3-chlorophenyl)-2,4-dinitroaniline?
The InChIKey is YLMKHXBXDKWQSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN3O4/c13-8-2-1-3-9(6-8)14-11-5-4-10(15(17)18)7-12(11)16(19)20/h1-7,14H.
What are the key properties of N-(3-chlorophenyl)-2,4-dinitroaniline?
N-(3-chlorophenyl)-2,4-dinitroaniline has a molecular weight of 293.67 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-2,4-dinitroaniline is sourced from PubChem (CID 27757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).