About 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine
4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine (PubChem CID 2775717) has the molecular formula C16H12Cl4N2
and a molecular weight of 374.10 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine |
| PubChem CID | 2775717 |
| Molecular Formula | C16H12Cl4N2 |
| Molecular Weight | 374.10 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine |
| SMILES | Clc1ccc(C2=Nc3ccccc3NC(C(Cl)(Cl)Cl)C2)cc1 |
| InChI | InChI=1S/C16H12Cl4N2/c17-11-7-5-10(6-8-11)14-9-15(16(18,19)20)22-13-4-2-1-3-12(13)21-14/h1-8,15,22H,9H2 |
| InChIKey | SNHMOUTVZLFRSB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.10 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine?
The IUPAC name of 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine (CID 2775717) is 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine.
What is the SMILES notation for 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine?
The canonical SMILES for 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine is Clc1ccc(C2=Nc3ccccc3NC(C(Cl)(Cl)Cl)C2)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine?
The InChIKey is SNHMOUTVZLFRSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl4N2/c17-11-7-5-10(6-8-11)14-9-15(16(18,19)20)22-13-4-2-1-3-12(13)21-14/h1-8,15,22H,9H2.
What are the key properties of 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine?
4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine has a molecular weight of 374.10 g/mol, XLogP of 6.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine is sourced from PubChem (CID 2775717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).