C4HF9 — CID 2775798
1,1,1,2,2,3,3,4,4-nonafluorobutane (PubChem CID 2775798) has the molecular formula C4HF9 and a molecular weight of 220.03 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluorobutane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 2775798 |
| Molecular Formula | C4HF9 |
| Molecular Weight | 220.03 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluorobutane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF9/c5-1(6)2(7,8)3(9,10)4(11,12)13/h1H |
| InChIKey | ZQTIKDIHRRLSRV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.03 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|