About (2R)-2-aminopropanamide;hydrochloride
(2R)-2-aminopropanamide;hydrochloride (PubChem CID 2775814) has the molecular formula C3H9ClN2O
and a molecular weight of 124.57 g/mol. Its IUPAC name is (2R)-2-aminopropanamide;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-aminopropanamide;hydrochloride |
| PubChem CID | 2775814 |
| Molecular Formula | C3H9ClN2O |
| Molecular Weight | 124.57 g/mol |
| Exact Mass | 124.04 |
| IUPAC Name | (2R)-2-aminopropanamide;hydrochloride |
| SMILES | C[C@@H](N)C(N)=O.Cl |
| InChI | InChI=1S/C3H8N2O.ClH/c1-2(4)3(5)6;/h2H,4H2,1H3,(H2,5,6);1H/t2-;/m1./s1 |
| InChIKey | FIAINKIUSZGVGX-HSHFZTNMSA-N |
| XLogP | -0.76 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.57 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-aminopropanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-aminopropanamide;hydrochloride?
The IUPAC name of (2R)-2-aminopropanamide;hydrochloride (CID 2775814) is (2R)-2-aminopropanamide;hydrochloride.
What is the SMILES notation for (2R)-2-aminopropanamide;hydrochloride?
The canonical SMILES for (2R)-2-aminopropanamide;hydrochloride is C[C@@H](N)C(N)=O.Cl.
What is the InChIKey of (2R)-2-aminopropanamide;hydrochloride?
The InChIKey is FIAINKIUSZGVGX-HSHFZTNMSA-N. The full InChI is InChI=1S/C3H8N2O.ClH/c1-2(4)3(5)6;/h2H,4H2,1H3,(H2,5,6);1H/t2-;/m1./s1.
What are the key properties of (2R)-2-aminopropanamide;hydrochloride?
(2R)-2-aminopropanamide;hydrochloride has a molecular weight of 124.57 g/mol, XLogP of -0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminopropanamide;hydrochloride is sourced from PubChem (CID 2775814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).