C7H5F9O — CID 2775815
4,4,5,5,6,6,7,7,7-nonafluorohept-2-en-1-ol (PubChem CID 2775815) has the molecular formula C7H5F9O and a molecular weight of 276.10 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluorohept-2-en-1-ol.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluorohept-2-en-1-ol |
|---|---|
| PubChem CID | 2775815 |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluorohept-2-en-1-ol |
| SMILES | OCC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O/c8-4(9,2-1-3-17)5(10,11)6(12,13)7(14,15)16/h1-2,17H,3H2 |
| InChIKey | PJZRJKWUZCHGGW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|