C4HF8I — CID 2775868
1,1,2,2,3,3,4,4-octafluoro-1-iodobutane (PubChem CID 2775868) has the molecular formula C4HF8I and a molecular weight of 327.94 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane |
|---|---|
| PubChem CID | 2775868 |
| Molecular Formula | C4HF8I |
| Molecular Weight | 327.94 g/mol |
| Exact Mass | 327.90 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C4HF8I/c5-1(6)2(7,8)3(9,10)4(11,12)13/h1H |
| InChIKey | YOCZVAMFHOCNFS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.94 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|