C5H3F8I — CID 2775883
1,1,2,2,3,3,4,4-octafluoro-5-iodopentane (PubChem CID 2775883) has the molecular formula C5H3F8I and a molecular weight of 341.97 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-5-iodopentane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-5-iodopentane |
|---|---|
| PubChem CID | 2775883 |
| Molecular Formula | C5H3F8I |
| Molecular Weight | 341.97 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-5-iodopentane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)CI |
| InChI | InChI=1S/C5H3F8I/c6-2(7)4(10,11)5(12,13)3(8,9)1-14/h2H,1H2 |
| InChIKey | YMGYSVVJRMSEGU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|