C4H2F8O — CID 2775955
1,1,1,2,2-pentafluoro-2-(2,2,2-trifluoroethoxy)ethane (PubChem CID 2775955) has the molecular formula C4H2F8O and a molecular weight of 218.04 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-2-(2,2,2-trifluoroethoxy)ethane.
| Compound Name | 1,1,1,2,2-pentafluoro-2-(2,2,2-trifluoroethoxy)ethane |
|---|---|
| PubChem CID | 2775955 |
| Molecular Formula | C4H2F8O |
| Molecular Weight | 218.04 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-2-(2,2,2-trifluoroethoxy)ethane |
| SMILES | FC(F)(F)COC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F8O/c5-2(6,7)1-13-4(11,12)3(8,9)10/h1H2 |
| InChIKey | ZOMISZRVOJQGOT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.04 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|