C8H2F8O — CID 2776026
1,2,3,4,5-pentafluoro-6-(2,2,2-trifluoroethoxy)benzene (PubChem CID 2776026) has the molecular formula C8H2F8O and a molecular weight of 266.09 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 2776026 |
| Molecular Formula | C8H2F8O |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2,2,2-trifluoroethoxy)benzene |
| SMILES | Fc1c(F)c(F)c(OCC(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C8H2F8O/c9-2-3(10)5(12)7(6(13)4(2)11)17-1-8(14,15)16/h1H2 |
| InChIKey | MCVAIMHKNJBNTQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|