C10H5F13 — CID 2776051
5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodeca-1,3-diene (PubChem CID 2776051) has the molecular formula C10H5F13 and a molecular weight of 372.12 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodeca-1,3-diene.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodeca-1,3-diene |
|---|---|
| PubChem CID | 2776051 |
| Molecular Formula | C10H5F13 |
| Molecular Weight | 372.12 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodeca-1,3-diene |
| SMILES | C=CC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F13/c1-2-3-4-5(11,12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h2-4H,1H2 |
| InChIKey | HALRAMNRSBXAOM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.12 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|