C9H16BrN — CID 2776089
4a-bromo-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 2776089) has the molecular formula C9H16BrN and a molecular weight of 218.14 g/mol. Its IUPAC name is 4a-bromo-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | 4a-bromo-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 2776089 |
| Molecular Formula | C9H16BrN |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 4a-bromo-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | BrC12CCCCC1CNCC2 |
| InChI | InChI=1S/C9H16BrN/c10-9-4-2-1-3-8(9)7-11-6-5-9/h8,11H,1-7H2 |
| InChIKey | FPUFEUQHVSBEPE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|