About 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride
4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride (PubChem CID 2776120) has the molecular formula C11H8ClNOS
and a molecular weight of 237.71 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride.
Molecular Properties
| Compound Name | 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride |
| PubChem CID | 2776120 |
| Molecular Formula | C11H8ClNOS |
| Molecular Weight | 237.71 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)Cl |
| InChI | InChI=1S/C11H8ClNOS/c1-7-9(10(12)14)15-11(13-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | ZQWZVEKZFVCSNY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride?
The IUPAC name of 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride (CID 2776120) is 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride.
What is the SMILES notation for 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride?
The canonical SMILES for 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride is Cc1nc(-c2ccccc2)sc1C(=O)Cl.
What is the InChIKey of 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride?
The InChIKey is ZQWZVEKZFVCSNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNOS/c1-7-9(10(12)14)15-11(13-7)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride?
4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride has a molecular weight of 237.71 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenyl-1,3-thiazole-5-carbonyl chloride is sourced from PubChem (CID 2776120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).