C6F13N — CID 2776242
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)piperidine (PubChem CID 2776242) has the molecular formula C6F13N and a molecular weight of 333.05 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 2776242 |
| Molecular Formula | C6F13N |
| Molecular Weight | 333.05 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6F13N/c7-1(8)2(9,10)4(13,14)20(6(17,18)19)5(15,16)3(1,11)12 |
| InChIKey | KCOKATNPCXDTEB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.05 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|