About 4-isothiocyanato-2,1,3-benzothiadiazole
4-isothiocyanato-2,1,3-benzothiadiazole (PubChem CID 2776285) has the molecular formula C7H3N3S2
and a molecular weight of 193.26 g/mol. Its IUPAC name is 4-isothiocyanato-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4-isothiocyanato-2,1,3-benzothiadiazole |
| PubChem CID | 2776285 |
| Molecular Formula | C7H3N3S2 |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | 4-isothiocyanato-2,1,3-benzothiadiazole |
| SMILES | S=C=Nc1cccc2nsnc12 |
| InChI | InChI=1S/C7H3N3S2/c11-4-8-5-2-1-3-6-7(5)10-12-9-6/h1-3H |
| InChIKey | JMBKFBYZSWMIOI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-isothiocyanato-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isothiocyanato-2,1,3-benzothiadiazole?
The IUPAC name of 4-isothiocyanato-2,1,3-benzothiadiazole (CID 2776285) is 4-isothiocyanato-2,1,3-benzothiadiazole.
What is the SMILES notation for 4-isothiocyanato-2,1,3-benzothiadiazole?
The canonical SMILES for 4-isothiocyanato-2,1,3-benzothiadiazole is S=C=Nc1cccc2nsnc12.
What is the InChIKey of 4-isothiocyanato-2,1,3-benzothiadiazole?
The InChIKey is JMBKFBYZSWMIOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N3S2/c11-4-8-5-2-1-3-6-7(5)10-12-9-6/h1-3H.
What are the key properties of 4-isothiocyanato-2,1,3-benzothiadiazole?
4-isothiocyanato-2,1,3-benzothiadiazole has a molecular weight of 193.26 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isothiocyanato-2,1,3-benzothiadiazole is sourced from PubChem (CID 2776285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).