About 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine
7-bromo-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 2776394) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine.
Molecular Properties
| Compound Name | 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine |
| PubChem CID | 2776394 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | Brc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C9H9BrO2/c10-7-2-3-8-9(6-7)12-5-1-4-11-8/h2-3,6H,1,4-5H2 |
| InChIKey | AZCHNKNSOZJHSH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine?
The IUPAC name of 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine (CID 2776394) is 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine.
What is the SMILES notation for 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine?
The canonical SMILES for 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine is Brc1ccc2c(c1)OCCCO2.
What is the InChIKey of 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine?
The InChIKey is AZCHNKNSOZJHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO2/c10-7-2-3-8-9(6-7)12-5-1-4-11-8/h2-3,6H,1,4-5H2.
What are the key properties of 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine?
7-bromo-3,4-dihydro-2H-1,5-benzodioxepine has a molecular weight of 229.07 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3,4-dihydro-2H-1,5-benzodioxepine is sourced from PubChem (CID 2776394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).