About 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine
7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 2776405) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 2776405 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2cc(Br)ccc21 |
| InChI | InChI=1S/C9H10BrNO/c1-11-4-5-12-9-6-7(10)2-3-8(9)11/h2-3,6H,4-5H2,1H3 |
| InChIKey | MQMFOFZKZBLSAB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine (CID 2776405) is 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine is CN1CCOc2cc(Br)ccc21.
What is the InChIKey of 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is MQMFOFZKZBLSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO/c1-11-4-5-12-9-6-7(10)2-3-8(9)11/h2-3,6H,4-5H2,1H3.
What are the key properties of 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine?
7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 228.09 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 2776405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).