C7H9NO2 — CID 2776468
3,5-dimethyl-1H-pyrrole-2-carboxylic acid (PubChem CID 2776468) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3,5-dimethyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 2776468 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(C)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C7H9NO2/c1-4-3-5(2)8-6(4)7(9)10/h3,8H,1-2H3,(H,9,10) |
| InChIKey | XQGVQRPSTODODM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |