C17H22N6O3S2 — CID 27764868
1-[4-(4-nitrophenyl)piperazin-1-yl]-2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 27764868) has the molecular formula C17H22N6O3S2 and a molecular weight of 422.54 g/mol. Its IUPAC name is 1-[4-(4-nitrophenyl)piperazin-1-yl]-2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-[4-(4-nitrophenyl)piperazin-1-yl]-2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 27764868 |
| Molecular Formula | C17H22N6O3S2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[4-(4-nitrophenyl)piperazin-1-yl]-2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | CCCNc1nnc(SCC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)s1 |
| InChI | InChI=1S/C17H22N6O3S2/c1-2-7-18-16-19-20-17(28-16)27-12-15(24)22-10-8-21(9-11-22)13-3-5-14(6-4-13)23(25)26/h3-6H,2,7-12H2,1H3,(H,18,19) |
| InChIKey | HWIBJMIMWCNBAT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|