About 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole
4-isocyanato-3-methyl-5-phenyl-1,2-oxazole (PubChem CID 2776517) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole |
| PubChem CID | 2776517 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole |
| SMILES | Cc1noc(-c2ccccc2)c1N=C=O |
| InChI | InChI=1S/C11H8N2O2/c1-8-10(12-7-14)11(15-13-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| InChIKey | ZSAPULDWGBONCI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole?
The IUPAC name of 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole (CID 2776517) is 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole.
What is the SMILES notation for 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole?
The canonical SMILES for 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole is Cc1noc(-c2ccccc2)c1N=C=O.
What is the InChIKey of 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole?
The InChIKey is ZSAPULDWGBONCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c1-8-10(12-7-14)11(15-13-8)9-5-3-2-4-6-9/h2-6H,1H3.
What are the key properties of 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole?
4-isocyanato-3-methyl-5-phenyl-1,2-oxazole has a molecular weight of 200.20 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanato-3-methyl-5-phenyl-1,2-oxazole is sourced from PubChem (CID 2776517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).