About ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 2776544) has the molecular formula C9H12ClNO4S
and a molecular weight of 265.72 g/mol. Its IUPAC name is ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 2776544 |
| Molecular Formula | C9H12ClNO4S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C9H12ClNO4S/c1-4-15-9(12)7-5(2)8(6(3)11-7)16(10,13)14/h11H,4H2,1-3H3 |
| InChIKey | IRBVAHDFENUACC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The IUPAC name of ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (CID 2776544) is ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is CCOC(=O)c1[nH]c(C)c(S(=O)(=O)Cl)c1C.
What is the InChIKey of ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The InChIKey is IRBVAHDFENUACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClNO4S/c1-4-15-9(12)7-5(2)8(6(3)11-7)16(10,13)14/h11H,4H2,1-3H3.
What are the key properties of ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate has a molecular weight of 265.72 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 2776544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).