About (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol
(5-thiophen-2-yl-1,2-oxazol-3-yl)methanol (PubChem CID 2776547) has the molecular formula C8H7NO2S
and a molecular weight of 181.22 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol.
Molecular Properties
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol |
| PubChem CID | 2776547 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol |
| SMILES | OCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C8H7NO2S/c10-5-6-4-7(11-9-6)8-2-1-3-12-8/h1-4,10H,5H2 |
| InChIKey | HUAGDHXVPCSWLD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol?
The IUPAC name of (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol (CID 2776547) is (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol.
What is the SMILES notation for (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol?
The canonical SMILES for (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol is OCc1cc(-c2cccs2)on1.
What is the InChIKey of (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol?
The InChIKey is HUAGDHXVPCSWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c10-5-6-4-7(11-9-6)8-2-1-3-12-8/h1-4,10H,5H2.
What are the key properties of (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol?
(5-thiophen-2-yl-1,2-oxazol-3-yl)methanol has a molecular weight of 181.22 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-thiophen-2-yl-1,2-oxazol-3-yl)methanol is sourced from PubChem (CID 2776547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).