About 2-morpholin-4-ylbenzoic acid
2-morpholin-4-ylbenzoic acid (PubChem CID 2776561) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-morpholin-4-ylbenzoic acid.
Molecular Properties
| Compound Name | 2-morpholin-4-ylbenzoic acid |
| PubChem CID | 2776561 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-morpholin-4-ylbenzoic acid |
| SMILES | O=C(O)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C11H13NO3/c13-11(14)9-3-1-2-4-10(9)12-5-7-15-8-6-12/h1-4H,5-8H2,(H,13,14) |
| InChIKey | XUBUJTVBAXQIKG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-morpholin-4-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylbenzoic acid?
The IUPAC name of 2-morpholin-4-ylbenzoic acid (CID 2776561) is 2-morpholin-4-ylbenzoic acid.
What is the SMILES notation for 2-morpholin-4-ylbenzoic acid?
The canonical SMILES for 2-morpholin-4-ylbenzoic acid is O=C(O)c1ccccc1N1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylbenzoic acid?
The InChIKey is XUBUJTVBAXQIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c13-11(14)9-3-1-2-4-10(9)12-5-7-15-8-6-12/h1-4H,5-8H2,(H,13,14).
What are the key properties of 2-morpholin-4-ylbenzoic acid?
2-morpholin-4-ylbenzoic acid has a molecular weight of 207.23 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylbenzoic acid is sourced from PubChem (CID 2776561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).