C8H4F4O2 — CID 2776587
5,6,7,8-tetrafluoro-2,3-dihydro-1,4-benzodioxine (PubChem CID 2776587) has the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoro-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5,6,7,8-tetrafluoro-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 2776587 |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 5,6,7,8-tetrafluoro-2,3-dihydro-1,4-benzodioxine |
| SMILES | Fc1c(F)c(F)c2c(c1F)OCCO2 |
| InChI | InChI=1S/C8H4F4O2/c9-3-4(10)6(12)8-7(5(3)11)13-1-2-14-8/h1-2H2 |
| InChIKey | KKPOQYDRSXVVEJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|