About 4-(1,1,2,2-tetrafluoroethoxy)aniline
4-(1,1,2,2-tetrafluoroethoxy)aniline (PubChem CID 2776630) has the molecular formula C8H7F4NO
and a molecular weight of 209.14 g/mol. Its IUPAC name is 4-(1,1,2,2-tetrafluoroethoxy)aniline.
Molecular Properties
| Compound Name | 4-(1,1,2,2-tetrafluoroethoxy)aniline |
| PubChem CID | 2776630 |
| Molecular Formula | C8H7F4NO |
| Molecular Weight | 209.14 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 4-(1,1,2,2-tetrafluoroethoxy)aniline |
| SMILES | Nc1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C8H7F4NO/c9-7(10)8(11,12)14-6-3-1-5(13)2-4-6/h1-4,7H,13H2 |
| InChIKey | ZQQSVTYLRGGCEI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.14 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,1,2,2-tetrafluoroethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1,2,2-tetrafluoroethoxy)aniline?
The IUPAC name of 4-(1,1,2,2-tetrafluoroethoxy)aniline (CID 2776630) is 4-(1,1,2,2-tetrafluoroethoxy)aniline.
What is the SMILES notation for 4-(1,1,2,2-tetrafluoroethoxy)aniline?
The canonical SMILES for 4-(1,1,2,2-tetrafluoroethoxy)aniline is Nc1ccc(OC(F)(F)C(F)F)cc1.
What is the InChIKey of 4-(1,1,2,2-tetrafluoroethoxy)aniline?
The InChIKey is ZQQSVTYLRGGCEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F4NO/c9-7(10)8(11,12)14-6-3-1-5(13)2-4-6/h1-4,7H,13H2.
What are the key properties of 4-(1,1,2,2-tetrafluoroethoxy)aniline?
4-(1,1,2,2-tetrafluoroethoxy)aniline has a molecular weight of 209.14 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1,2,2-tetrafluoroethoxy)aniline is sourced from PubChem (CID 2776630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).