C5H4F8O — CID 2776662
1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane (PubChem CID 2776662) has the molecular formula C5H4F8O and a molecular weight of 232.07 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane.
| Compound Name | 1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane |
|---|---|
| PubChem CID | 2776662 |
| Molecular Formula | C5H4F8O |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane |
| SMILES | FC(F)C(F)(F)COC(F)(F)C(F)F |
| InChI | InChI=1S/C5H4F8O/c6-2(7)4(10,11)1-14-5(12,13)3(8)9/h2-3H,1H2 |
| InChIKey | HCBRSIIGBBDDCD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|