About 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride
2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride (PubChem CID 2776665) has the molecular formula C5H9ClN4S
and a molecular weight of 192.68 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride |
| PubChem CID | 2776665 |
| Molecular Formula | C5H9ClN4S |
| Molecular Weight | 192.68 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride |
| SMILES | Cc1csc(N=C(N)N)n1.Cl |
| InChI | InChI=1S/C5H8N4S.ClH/c1-3-2-10-5(8-3)9-4(6)7;/h2H,1H3,(H4,6,7,8,9);1H |
| InChIKey | AYUMBOOFVFTIOJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.68 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride?
The IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride (CID 2776665) is 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride is Cc1csc(N=C(N)N)n1.Cl.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride?
The InChIKey is AYUMBOOFVFTIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4S.ClH/c1-3-2-10-5(8-3)9-4(6)7;/h2H,1H3,(H4,6,7,8,9);1H.
What are the key properties of 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride?
2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride has a molecular weight of 192.68 g/mol, XLogP of 0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-2-yl)guanidine;hydrochloride is sourced from PubChem (CID 2776665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).