C10H12N2S — CID 2776794
2-(1,4,5,6-tetrahydropyrimidin-2-yl)benzenethiol (PubChem CID 2776794) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 2-(1,4,5,6-tetrahydropyrimidin-2-yl)benzenethiol.
| Compound Name | 2-(1,4,5,6-tetrahydropyrimidin-2-yl)benzenethiol |
|---|---|
| PubChem CID | 2776794 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-(1,4,5,6-tetrahydropyrimidin-2-yl)benzenethiol |
| SMILES | Sc1ccccc1C1=NCCCN1 |
| InChI | InChI=1S/C10H12N2S/c13-9-5-2-1-4-8(9)10-11-6-3-7-12-10/h1-2,4-5,13H,3,6-7H2,(H,11,12) |
| InChIKey | DUHDUYRXLGSMLQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|