C13H16ClN3O2S — CID 27768458
N-[(4bR,8aS)-2-methyl-4-oxo-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-2-chloroacetamide (PubChem CID 27768458) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is N-[(4bR,8aS)-2-methyl-4-oxo-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-2-chloroacetamide.
| Compound Name | N-[(4bR,8aS)-2-methyl-4-oxo-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 27768458 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[(4bR,8aS)-2-methyl-4-oxo-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-2-chloroacetamide |
| SMILES | Cc1nc2c(c(=O)n1NC(=O)CCl)[C@H]1CCCC[C@@H]1S2 |
| InChI | InChI=1S/C13H16ClN3O2S/c1-7-15-12-11(8-4-2-3-5-9(8)20-12)13(19)17(7)16-10(18)6-14/h8-9H,2-6H2,1H3,(H,16,18)/t8-,9-/m0/s1 |
| InChIKey | WPJXFJRGSAPKJR-IUCAKERBSA-N |
| XLogP | 1.99 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|