About methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate
methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 2776915) has the molecular formula C6H8F3NO3S
and a molecular weight of 231.19 g/mol. Its IUPAC name is methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| PubChem CID | 2776915 |
| Molecular Formula | C6H8F3NO3S |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | COC(=O)[C@H](CS)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H8F3NO3S/c1-13-4(11)3(2-14)10-5(12)6(7,8)9/h3,14H,2H2,1H3,(H,10,12)/t3-/m0/s1 |
| InChIKey | VWGSQMAKRLENER-VKHMYHEASA-N |
| XLogP | 0.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The IUPAC name of methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (CID 2776915) is methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
What is the SMILES notation for methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The canonical SMILES for methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate is COC(=O)[C@H](CS)NC(=O)C(F)(F)F.
What is the InChIKey of methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The InChIKey is VWGSQMAKRLENER-VKHMYHEASA-N. The full InChI is InChI=1S/C6H8F3NO3S/c1-13-4(11)3(2-14)10-5(12)6(7,8)9/h3,14H,2H2,1H3,(H,10,12)/t3-/m0/s1.
What are the key properties of methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate has a molecular weight of 231.19 g/mol, XLogP of 0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate is sourced from PubChem (CID 2776915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).