About bis(N,N-diethylcarbamodithioate);tin(2+)
bis(N,N-diethylcarbamodithioate);tin(2+) (PubChem CID 27770) has the molecular formula C10H20N2S4Sn
and a molecular weight of 415.26 g/mol. Its IUPAC name is bis(N,N-diethylcarbamodithioate);tin(2+).
Molecular Properties
| Compound Name | bis(N,N-diethylcarbamodithioate);tin(2+) |
| PubChem CID | 27770 |
| Molecular Formula | C10H20N2S4Sn |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | bis(N,N-diethylcarbamodithioate);tin(2+) |
| SMILES | CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Sn+2] |
| InChI | InChI=1S/2C5H11NS2.Sn/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | UXPVPFVRBBOKPF-UHFFFAOYSA-L |
| XLogP | 1.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(N,N-diethylcarbamodithioate);tin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N,N-diethylcarbamodithioate);tin(2+)?
The IUPAC name of bis(N,N-diethylcarbamodithioate);tin(2+) (CID 27770) is bis(N,N-diethylcarbamodithioate);tin(2+).
What is the SMILES notation for bis(N,N-diethylcarbamodithioate);tin(2+)?
The canonical SMILES for bis(N,N-diethylcarbamodithioate);tin(2+) is CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Sn+2].
What is the InChIKey of bis(N,N-diethylcarbamodithioate);tin(2+)?
The InChIKey is UXPVPFVRBBOKPF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H11NS2.Sn/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2.
What are the key properties of bis(N,N-diethylcarbamodithioate);tin(2+)?
bis(N,N-diethylcarbamodithioate);tin(2+) has a molecular weight of 415.26 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N,N-diethylcarbamodithioate);tin(2+) is sourced from PubChem (CID 27770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).