About 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide
5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide (PubChem CID 2777158) has the molecular formula C5H9ClN4O2S
and a molecular weight of 224.67 g/mol. Its IUPAC name is 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide.
Molecular Properties
| Compound Name | 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide |
| PubChem CID | 2777158 |
| Molecular Formula | C5H9ClN4O2S |
| Molecular Weight | 224.67 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)NN |
| InChI | InChI=1S/C5H9ClN4O2S/c1-3-4(13(11,12)9-7)5(6)10(2)8-3/h9H,7H2,1-2H3 |
| InChIKey | BYXRCFNHMPQUNZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.67 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide?
The IUPAC name of 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide (CID 2777158) is 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide.
What is the SMILES notation for 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide?
The canonical SMILES for 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide is Cc1nn(C)c(Cl)c1S(=O)(=O)NN.
What is the InChIKey of 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide?
The InChIKey is BYXRCFNHMPQUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClN4O2S/c1-3-4(13(11,12)9-7)5(6)10(2)8-3/h9H,7H2,1-2H3.
What are the key properties of 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide?
5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide has a molecular weight of 224.67 g/mol, XLogP of -0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-dimethylpyrazole-4-sulfonohydrazide is sourced from PubChem (CID 2777158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).