About N'-aminomorpholine-4-carboximidamide;hydroiodide
N'-aminomorpholine-4-carboximidamide;hydroiodide (PubChem CID 2777306) has the molecular formula C5H13IN4O
and a molecular weight of 272.09 g/mol. Its IUPAC name is N'-aminomorpholine-4-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N'-aminomorpholine-4-carboximidamide;hydroiodide |
| PubChem CID | 2777306 |
| Molecular Formula | C5H13IN4O |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | N'-aminomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.NN=C(N)N1CCOCC1 |
| InChI | InChI=1S/C5H12N4O.HI/c6-5(8-7)9-1-3-10-4-2-9;/h1-4,7H2,(H2,6,8);1H |
| InChIKey | YXNSDJJTIYZVOV-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-aminomorpholine-4-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-aminomorpholine-4-carboximidamide;hydroiodide?
The IUPAC name of N'-aminomorpholine-4-carboximidamide;hydroiodide (CID 2777306) is N'-aminomorpholine-4-carboximidamide;hydroiodide.
What is the SMILES notation for N'-aminomorpholine-4-carboximidamide;hydroiodide?
The canonical SMILES for N'-aminomorpholine-4-carboximidamide;hydroiodide is I.NN=C(N)N1CCOCC1.
What is the InChIKey of N'-aminomorpholine-4-carboximidamide;hydroiodide?
The InChIKey is YXNSDJJTIYZVOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O.HI/c6-5(8-7)9-1-3-10-4-2-9;/h1-4,7H2,(H2,6,8);1H.
What are the key properties of N'-aminomorpholine-4-carboximidamide;hydroiodide?
N'-aminomorpholine-4-carboximidamide;hydroiodide has a molecular weight of 272.09 g/mol, XLogP of -0.88, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-aminomorpholine-4-carboximidamide;hydroiodide is sourced from PubChem (CID 2777306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).