C21H21F3N4O2S2 — CID 27773070
2-[[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 27773070) has the molecular formula C21H21F3N4O2S2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 2-[[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 27773070 |
| Molecular Formula | C21H21F3N4O2S2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2-[[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)CSc1ncnc2sc(C)c(C)c12 |
| InChI | InChI=1S/C21H21F3N4O2S2/c1-4-7-28(8-15(29)27-14-6-5-13(22)18(23)19(14)24)16(30)9-31-20-17-11(2)12(3)32-21(17)26-10-25-20/h5-6,10H,4,7-9H2,1-3H3,(H,27,29) |
| InChIKey | PMPYEAASLINKBA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|