About 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one
3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one (PubChem CID 2777367) has the molecular formula C17H14O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one.
Molecular Properties
| Compound Name | 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
| PubChem CID | 2777367 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
| SMILES | O=C1c2ccccc2CCC12OC2c1ccccc1 |
| InChI | InChI=1S/C17H14O2/c18-15-14-9-5-4-6-12(14)10-11-17(15)16(19-17)13-7-2-1-3-8-13/h1-9,16H,10-11H2 |
| InChIKey | KEGOBJMZUSOZFM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one?
The IUPAC name of 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one (CID 2777367) is 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one.
What is the SMILES notation for 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one?
The canonical SMILES for 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one is O=C1c2ccccc2CCC12OC2c1ccccc1.
What is the InChIKey of 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one?
The InChIKey is KEGOBJMZUSOZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O2/c18-15-14-9-5-4-6-12(14)10-11-17(15)16(19-17)13-7-2-1-3-8-13/h1-9,16H,10-11H2.
What are the key properties of 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one?
3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one has a molecular weight of 250.30 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-phenylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one is sourced from PubChem (CID 2777367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).