About N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide
N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide (PubChem CID 2777716) has the molecular formula C18H22BrN3O4
and a molecular weight of 424.30 g/mol. Its IUPAC name is N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide.
Molecular Properties
| Compound Name | N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide |
| PubChem CID | 2777716 |
| Molecular Formula | C18H22BrN3O4 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)C(C)Br)c(-n2c(C)ccc2C)cc1OC |
| InChI | InChI=1S/C18H22BrN3O4/c1-10-6-7-11(2)22(10)14-9-16(26-5)15(25-4)8-13(14)18(24)21-20-17(23)12(3)19/h6-9,12H,1-5H3,(H,20,23)(H,21,24) |
| InChIKey | CKWUBHFSOSTYJS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide?
The IUPAC name of N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide (CID 2777716) is N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide.
What is the SMILES notation for N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide?
The canonical SMILES for N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide is COc1cc(C(=O)NNC(=O)C(C)Br)c(-n2c(C)ccc2C)cc1OC.
What is the InChIKey of N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide?
The InChIKey is CKWUBHFSOSTYJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22BrN3O4/c1-10-6-7-11(2)22(10)14-9-16(26-5)15(25-4)8-13(14)18(24)21-20-17(23)12(3)19/h6-9,12H,1-5H3,(H,20,23)(H,21,24).
What are the key properties of N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide?
N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide has a molecular weight of 424.30 g/mol, XLogP of 2.66, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-bromopropanoyl)-2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzohydrazide is sourced from PubChem (CID 2777716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).