C9H18N6 — CID 27778
2-N,4-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 27778) has the molecular formula C9H18N6 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-N,4-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 27778 |
| Molecular Formula | C9H18N6 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-N,4-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCC)nc(NCC)n1 |
| InChI | InChI=1S/C9H18N6/c1-4-10-7-13-8(11-5-2)15-9(14-7)12-6-3/h4-6H2,1-3H3,(H3,10,11,12,13,14,15) |
| InChIKey | LNCCBHFAHILMCT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |