C9H7F3O2S — CID 2777969
3,3,3-trifluoroprop-1-enylsulfonylbenzene (PubChem CID 2777969) has the molecular formula C9H7F3O2S and a molecular weight of 236.21 g/mol. Its IUPAC name is 3,3,3-trifluoroprop-1-enylsulfonylbenzene.
| Compound Name | 3,3,3-trifluoroprop-1-enylsulfonylbenzene |
|---|---|
| PubChem CID | 2777969 |
| Molecular Formula | C9H7F3O2S |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 3,3,3-trifluoroprop-1-enylsulfonylbenzene |
| SMILES | O=S(=O)(C=CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H7F3O2S/c10-9(11,12)6-7-15(13,14)8-4-2-1-3-5-8/h1-7H |
| InChIKey | MXCAYGIFNXCLMK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |