About trifluoromethanesulfonate;2,4,6-triphenylpyrylium
trifluoromethanesulfonate;2,4,6-triphenylpyrylium (PubChem CID 2778031) has the molecular formula C24H17F3O4S
and a molecular weight of 458.46 g/mol. Its IUPAC name is trifluoromethanesulfonate;2,4,6-triphenylpyrylium.
Molecular Properties
| Compound Name | trifluoromethanesulfonate;2,4,6-triphenylpyrylium |
| PubChem CID | 2778031 |
| Molecular Formula | C24H17F3O4S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | trifluoromethanesulfonate;2,4,6-triphenylpyrylium |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H17O.CHF3O3S/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20;2-1(3,4)8(5,6)7/h1-17H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YLZGGQOWTSBLMX-UHFFFAOYSA-M |
| XLogP | 6.61 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanesulfonate;2,4,6-triphenylpyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanesulfonate;2,4,6-triphenylpyrylium?
The IUPAC name of trifluoromethanesulfonate;2,4,6-triphenylpyrylium (CID 2778031) is trifluoromethanesulfonate;2,4,6-triphenylpyrylium.
What is the SMILES notation for trifluoromethanesulfonate;2,4,6-triphenylpyrylium?
The canonical SMILES for trifluoromethanesulfonate;2,4,6-triphenylpyrylium is O=S(=O)([O-])C(F)(F)F.c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1.
What is the InChIKey of trifluoromethanesulfonate;2,4,6-triphenylpyrylium?
The InChIKey is YLZGGQOWTSBLMX-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H17O.CHF3O3S/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20;2-1(3,4)8(5,6)7/h1-17H;(H,5,6,7)/q+1;/p-1.
What are the key properties of trifluoromethanesulfonate;2,4,6-triphenylpyrylium?
trifluoromethanesulfonate;2,4,6-triphenylpyrylium has a molecular weight of 458.46 g/mol, XLogP of 6.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanesulfonate;2,4,6-triphenylpyrylium is sourced from PubChem (CID 2778031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).