About tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide
tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 2778201) has the molecular formula C32H12BF24-
and a molecular weight of 863.21 g/mol. Its IUPAC name is tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
Molecular Properties
| Compound Name | tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| PubChem CID | 2778201 |
| Molecular Formula | C32H12BF24- |
| Molecular Weight | 863.21 g/mol |
| Exact Mass | 863.07 |
| IUPAC Name | tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H12BF24/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57/h1-12H/q-1 |
| InChIKey | JNFDRDAXBUYMLD-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 863.21 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide?
The IUPAC name of tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (CID 2778201) is tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
What is the SMILES notation for tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide?
The canonical SMILES for tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide is FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.
What is the InChIKey of tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide?
The InChIKey is JNFDRDAXBUYMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H12BF24/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57/h1-12H/q-1.
What are the key properties of tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide?
tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide has a molecular weight of 863.21 g/mol, XLogP of 11.21, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide is sourced from PubChem (CID 2778201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).