C16H23ClN2O3S — CID 27782107
N-[(1R)-1-(4-chlorophenyl)ethyl]-1-ethylsulfonylpiperidine-4-carboxamide (PubChem CID 27782107) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-1-ethylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-1-ethylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 27782107 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-1-ethylsulfonylpiperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)N[C@H](C)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H23ClN2O3S/c1-3-23(21,22)19-10-8-14(9-11-19)16(20)18-12(2)13-4-6-15(17)7-5-13/h4-7,12,14H,3,8-11H2,1-2H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | JHVWCPHGMBUTRW-GFCCVEGCSA-N |
| XLogP | 2.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |