5-chloro-2-fluorobenzenesulfonyl chloride

C6H3Cl2FO2S — CID 2778273

IUPAC5-chloro-2-fluorobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Cl)ccc1F
InChIInChI=1S/C6H3Cl2FO2S/c7-4-1-2-5(9)6(3-4)12(8,10)11/h1-3H
InChIKeyOZKAHSNNKADHTK-UHFFFAOYSA-N
MW229.06 g/mol
LogP2.41
Rot. Bonds1

About 5-chloro-2-fluorobenzenesulfonyl chloride

5-chloro-2-fluorobenzenesulfonyl chloride (PubChem CID 2778273) has the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. Its IUPAC name is 5-chloro-2-fluorobenzenesulfonyl chloride.

Molecular Properties

Compound Name5-chloro-2-fluorobenzenesulfonyl chloride
PubChem CID2778273
Molecular FormulaC6H3Cl2FO2S
Molecular Weight229.06 g/mol
Exact Mass227.92
IUPAC Name5-chloro-2-fluorobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Cl)ccc1F
InChIInChI=1S/C6H3Cl2FO2S/c7-4-1-2-5(9)6(3-4)12(8,10)11/h1-3H
InChIKeyOZKAHSNNKADHTK-UHFFFAOYSA-N
XLogP2.41
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.06
LogP ≤ 52.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 5-chloro-2-fluorobenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2-fluorobenzenesulfonyl chloride?
The IUPAC name of 5-chloro-2-fluorobenzenesulfonyl chloride (CID 2778273) is 5-chloro-2-fluorobenzenesulfonyl chloride.
What is the SMILES notation for 5-chloro-2-fluorobenzenesulfonyl chloride?
The canonical SMILES for 5-chloro-2-fluorobenzenesulfonyl chloride is O=S(=O)(Cl)c1cc(Cl)ccc1F.
What is the InChIKey of 5-chloro-2-fluorobenzenesulfonyl chloride?
The InChIKey is OZKAHSNNKADHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2FO2S/c7-4-1-2-5(9)6(3-4)12(8,10)11/h1-3H.
What are the key properties of 5-chloro-2-fluorobenzenesulfonyl chloride?
5-chloro-2-fluorobenzenesulfonyl chloride has a molecular weight of 229.06 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-fluorobenzenesulfonyl chloride is sourced from PubChem (CID 2778273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).